C22H26N2O — CID 135025995
2-(1-methoxy-2',2'-dimethylspiro[2,3-dihydro-1H-naphthalene-4,4'-3H-pyrrole]-5'-yl)aniline (PubChem CID 135025995) has the molecular formula C22H26N2O and a molecular weight of 334.46 g/mol. Its IUPAC name is 2-(1-methoxy-2',2'-dimethylspiro[2,3-dihydro-1H-naphthalene-4,4'-3H-pyrrole]-5'-yl)aniline.
| Compound Name | 2-(1-methoxy-2',2'-dimethylspiro[2,3-dihydro-1H-naphthalene-4,4'-3H-pyrrole]-5'-yl)aniline |
|---|---|
| PubChem CID | 135025995 |
| Molecular Formula | C22H26N2O |
| Molecular Weight | 334.46 g/mol |
| Exact Mass | 334.20 |
| IUPAC Name | 2-(1-methoxy-2',2'-dimethylspiro[2,3-dihydro-1H-naphthalene-4,4'-3H-pyrrole]-5'-yl)aniline |
| SMILES | COC1CCC2(CC(C)(C)N=C2c2ccccc2N)c2ccccc21 |
| InChI | InChI=1S/C22H26N2O/c1-21(2)14-22(20(24-21)16-9-5-7-11-18(16)23)13-12-19(25-3)15-8-4-6-10-17(15)22/h4-11,19H,12-14,23H2,1-3H3 |
| InChIKey | CUFSOCFZSBZTNA-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 47.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.46 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|