C17H25NO3 — CID 135027963
2-[(3aS,4S,6R,6aR)-5-benzyl-2,2,6-trimethyl-3a,4,6,6a-tetrahydro-[1,3]dioxolo[4,5-c]pyrrol-4-yl]ethanol (PubChem CID 135027963) has the molecular formula C17H25NO3 and a molecular weight of 291.39 g/mol. Its IUPAC name is 2-[(3aS,4S,6R,6aR)-5-benzyl-2,2,6-trimethyl-3a,4,6,6a-tetrahydro-[1,3]dioxolo[4,5-c]pyrrol-4-yl]ethanol.
| Compound Name | 2-[(3aS,4S,6R,6aR)-5-benzyl-2,2,6-trimethyl-3a,4,6,6a-tetrahydro-[1,3]dioxolo[4,5-c]pyrrol-4-yl]ethanol |
|---|---|
| PubChem CID | 135027963 |
| Molecular Formula | C17H25NO3 |
| Molecular Weight | 291.39 g/mol |
| Exact Mass | 291.18 |
| IUPAC Name | 2-[(3aS,4S,6R,6aR)-5-benzyl-2,2,6-trimethyl-3a,4,6,6a-tetrahydro-[1,3]dioxolo[4,5-c]pyrrol-4-yl]ethanol |
| SMILES | C[C@@H]1[C@H]2OC(C)(C)O[C@H]2[C@H](CCO)N1Cc1ccccc1 |
| InChI | InChI=1S/C17H25NO3/c1-12-15-16(21-17(2,3)20-15)14(9-10-19)18(12)11-13-7-5-4-6-8-13/h4-8,12,14-16,19H,9-11H2,1-3H3/t12-,14+,15-,16+/m1/s1 |
| InChIKey | KZHXZYUOONTIIX-BVUBDWEXSA-N |
| XLogP | 2.16 |
| TPSA | 41.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.39 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |