C16H18F3NO3 — CID 135028736
tert-butyl N-(phenoxymethyl)-N-(4,4,4-trifluorobuta-1,2-dienyl)carbamate (PubChem CID 135028736) has the molecular formula C16H18F3NO3 and a molecular weight of 329.32 g/mol. Its IUPAC name is tert-butyl N-(phenoxymethyl)-N-(4,4,4-trifluorobuta-1,2-dienyl)carbamate.
| Compound Name | tert-butyl N-(phenoxymethyl)-N-(4,4,4-trifluorobuta-1,2-dienyl)carbamate |
|---|---|
| PubChem CID | 135028736 |
| Molecular Formula | C16H18F3NO3 |
| Molecular Weight | 329.32 g/mol |
| Exact Mass | 329.12 |
| IUPAC Name | tert-butyl N-(phenoxymethyl)-N-(4,4,4-trifluorobuta-1,2-dienyl)carbamate |
| SMILES | CC(C)(C)OC(=O)N(C=C=CC(F)(F)F)COc1ccccc1 |
| InChI | InChI=1S/C16H18F3NO3/c1-15(2,3)23-14(21)20(11-7-10-16(17,18)19)12-22-13-8-5-4-6-9-13/h4-6,8-11H,12H2,1-3H3 |
| InChIKey | HIXPDJVYKDRBHD-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.32 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|