C18H23NO12S — CID 135031348
ethyl (5S,8R)-6,7,8-triacetyloxy-9-(acetyloxymethyl)-1,10-dioxa-4-thia-2-azaspiro[4.5]dec-2-ene-3-carboxylate (PubChem CID 135031348) has the molecular formula C18H23NO12S and a molecular weight of 477.44 g/mol. Its IUPAC name is ethyl (5S,8R)-6,7,8-triacetyloxy-9-(acetyloxymethyl)-1,10-dioxa-4-thia-2-azaspiro[4.5]dec-2-ene-3-carboxylate.
| Compound Name | ethyl (5S,8R)-6,7,8-triacetyloxy-9-(acetyloxymethyl)-1,10-dioxa-4-thia-2-azaspiro[4.5]dec-2-ene-3-carboxylate |
|---|---|
| PubChem CID | 135031348 |
| Molecular Formula | C18H23NO12S |
| Molecular Weight | 477.44 g/mol |
| Exact Mass | 477.09 |
| IUPAC Name | ethyl (5S,8R)-6,7,8-triacetyloxy-9-(acetyloxymethyl)-1,10-dioxa-4-thia-2-azaspiro[4.5]dec-2-ene-3-carboxylate |
| SMILES | CCOC(=O)C1=NO[C@]2(OC(COC(C)=O)[C@@H](OC(C)=O)C(OC(C)=O)C2OC(C)=O)S1 |
| InChI | InChI=1S/C18H23NO12S/c1-6-25-17(24)16-19-31-18(32-16)15(29-11(5)23)14(28-10(4)22)13(27-9(3)21)12(30-18)7-26-8(2)20/h12-15H,6-7H2,1-5H3/t12?,13-,14?,15?,18+/m1/s1 |
| InChIKey | HYIZBKFPFPKHFF-HABKUVDVSA-N |
| XLogP | 0.04 |
| TPSA | 162.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.44 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|