C15H22F3O5S2+ — CID 135032983
[2-[[(1S)-1-methoxypropoxy]methyl]phenyl]-propan-2-yl-(trifluoromethylsulfonyloxy)sulfanium (PubChem CID 135032983) has the molecular formula C15H22F3O5S2+ and a molecular weight of 403.46 g/mol. Its IUPAC name is [2-[[(1S)-1-methoxypropoxy]methyl]phenyl]-propan-2-yl-(trifluoromethylsulfonyloxy)sulfanium.
| Compound Name | [2-[[(1S)-1-methoxypropoxy]methyl]phenyl]-propan-2-yl-(trifluoromethylsulfonyloxy)sulfanium |
|---|---|
| PubChem CID | 135032983 |
| Molecular Formula | C15H22F3O5S2+ |
| Molecular Weight | 403.46 g/mol |
| Exact Mass | 403.09 |
| IUPAC Name | [2-[[(1S)-1-methoxypropoxy]methyl]phenyl]-propan-2-yl-(trifluoromethylsulfonyloxy)sulfanium |
| SMILES | CC[C@@H](OC)OCc1ccccc1[S+](OS(=O)(=O)C(F)(F)F)C(C)C |
| InChI | InChI=1S/C15H22F3O5S2/c1-5-14(21-4)22-10-12-8-6-7-9-13(12)24(11(2)3)23-25(19,20)15(16,17)18/h6-9,11,14H,5,10H2,1-4H3/q+1/t14-,24?/m0/s1 |
| InChIKey | CTQKCPAUBKUZQG-LNYMIDHXSA-N |
| XLogP | 3.75 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.46 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|