C12H8BrN3O2 — CID 135033137
6-bromo-4-(1,2,4-triazol-1-yl)naphthalene-1,2-diol (PubChem CID 135033137) has the molecular formula C12H8BrN3O2 and a molecular weight of 306.12 g/mol. Its IUPAC name is 6-bromo-4-(1,2,4-triazol-1-yl)naphthalene-1,2-diol.
| Compound Name | 6-bromo-4-(1,2,4-triazol-1-yl)naphthalene-1,2-diol |
|---|---|
| PubChem CID | 135033137 |
| Molecular Formula | C12H8BrN3O2 |
| Molecular Weight | 306.12 g/mol |
| Exact Mass | 304.98 |
| IUPAC Name | 6-bromo-4-(1,2,4-triazol-1-yl)naphthalene-1,2-diol |
| SMILES | Oc1cc(-n2cncn2)c2cc(Br)ccc2c1O |
| InChI | InChI=1S/C12H8BrN3O2/c13-7-1-2-8-9(3-7)10(4-11(17)12(8)18)16-6-14-5-15-16/h1-6,17-18H |
| InChIKey | XNQCCEJKEQPPEQ-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 71.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.12 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|