C11H11F2NO2 — CID 135033268
(E,2S)-2-amino-5-(2,4-difluorophenyl)pent-4-enoic acid (PubChem CID 135033268) has the molecular formula C11H11F2NO2 and a molecular weight of 227.21 g/mol. Its IUPAC name is (E,2S)-2-amino-5-(2,4-difluorophenyl)pent-4-enoic acid.
| Compound Name | (E,2S)-2-amino-5-(2,4-difluorophenyl)pent-4-enoic acid |
|---|---|
| PubChem CID | 135033268 |
| Molecular Formula | C11H11F2NO2 |
| Molecular Weight | 227.21 g/mol |
| Exact Mass | 227.08 |
| IUPAC Name | (E,2S)-2-amino-5-(2,4-difluorophenyl)pent-4-enoic acid |
| SMILES | N[C@@H](C/C=C/c1ccc(F)cc1F)C(=O)O |
| InChI | InChI=1S/C11H11F2NO2/c12-8-5-4-7(9(13)6-8)2-1-3-10(14)11(15)16/h1-2,4-6,10H,3,14H2,(H,15,16)/b2-1+/t10-/m0/s1 |
| InChIKey | RJPMAPMFAUSSNM-YOLVWIGZSA-N |
| XLogP | 1.78 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.21 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |