C22H22O7 — CID 135035142
1-[7-methoxy-6-(4-methoxy-6-prop-2-enyl-1,3-benzodioxol-5-yl)-1,3-benzodioxol-5-yl]prop-2-en-1-ol (PubChem CID 135035142) has the molecular formula C22H22O7 and a molecular weight of 398.41 g/mol. Its IUPAC name is 1-[7-methoxy-6-(4-methoxy-6-prop-2-enyl-1,3-benzodioxol-5-yl)-1,3-benzodioxol-5-yl]prop-2-en-1-ol.
| Compound Name | 1-[7-methoxy-6-(4-methoxy-6-prop-2-enyl-1,3-benzodioxol-5-yl)-1,3-benzodioxol-5-yl]prop-2-en-1-ol |
|---|---|
| PubChem CID | 135035142 |
| Molecular Formula | C22H22O7 |
| Molecular Weight | 398.41 g/mol |
| Exact Mass | 398.14 |
| IUPAC Name | 1-[7-methoxy-6-(4-methoxy-6-prop-2-enyl-1,3-benzodioxol-5-yl)-1,3-benzodioxol-5-yl]prop-2-en-1-ol |
| SMILES | C=CCc1cc2c(c(OC)c1-c1c(C(O)C=C)cc3c(c1OC)OCO3)OCO2 |
| InChI | InChI=1S/C22H22O7/c1-5-7-12-8-15-19(28-10-26-15)21(24-3)17(12)18-13(14(23)6-2)9-16-20(22(18)25-4)29-11-27-16/h5-6,8-9,14,23H,1-2,7,10-11H2,3-4H3 |
| InChIKey | PKSZEHBTMIHEAX-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 75.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.41 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|