C12H19IO2 — CID 135036735
1-[(1R,2R)-2-ethenyl-5-[(1R)-1-hydroxy-2-iodoethyl]-1-methylcyclopentyl]ethanone (PubChem CID 135036735) has the molecular formula C12H19IO2 and a molecular weight of 322.19 g/mol. Its IUPAC name is 1-[(1R,2R)-2-ethenyl-5-[(1R)-1-hydroxy-2-iodoethyl]-1-methylcyclopentyl]ethanone.
| Compound Name | 1-[(1R,2R)-2-ethenyl-5-[(1R)-1-hydroxy-2-iodoethyl]-1-methylcyclopentyl]ethanone |
|---|---|
| PubChem CID | 135036735 |
| Molecular Formula | C12H19IO2 |
| Molecular Weight | 322.19 g/mol |
| Exact Mass | 322.04 |
| IUPAC Name | 1-[(1R,2R)-2-ethenyl-5-[(1R)-1-hydroxy-2-iodoethyl]-1-methylcyclopentyl]ethanone |
| SMILES | C=C[C@H]1CCC([C@@H](O)CI)[C@]1(C)C(C)=O |
| InChI | InChI=1S/C12H19IO2/c1-4-9-5-6-10(11(15)7-13)12(9,3)8(2)14/h4,9-11,15H,1,5-7H2,2-3H3/t9-,10?,11-,12+/m0/s1 |
| InChIKey | SRBSESCBBDNMGR-YEJSDXFRSA-N |
| XLogP | 2.59 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.19 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|