C22H25N3O5 — CID 135037263
[(2S,5S)-4-azido-6-methyl-3,5-bis(phenylmethoxy)oxan-2-yl] acetate (PubChem CID 135037263) has the molecular formula C22H25N3O5 and a molecular weight of 411.46 g/mol. Its IUPAC name is [(2S,5S)-4-azido-6-methyl-3,5-bis(phenylmethoxy)oxan-2-yl] acetate.
| Compound Name | [(2S,5S)-4-azido-6-methyl-3,5-bis(phenylmethoxy)oxan-2-yl] acetate |
|---|---|
| PubChem CID | 135037263 |
| Molecular Formula | C22H25N3O5 |
| Molecular Weight | 411.46 g/mol |
| Exact Mass | 411.18 |
| IUPAC Name | [(2S,5S)-4-azido-6-methyl-3,5-bis(phenylmethoxy)oxan-2-yl] acetate |
| SMILES | CC(=O)O[C@@H]1OC(C)[C@@H](OCc2ccccc2)C(N=[N+]=[N-])C1OCc1ccccc1 |
| InChI | InChI=1S/C22H25N3O5/c1-15-20(27-13-17-9-5-3-6-10-17)19(24-25-23)21(22(29-15)30-16(2)26)28-14-18-11-7-4-8-12-18/h3-12,15,19-22H,13-14H2,1-2H3/t15?,19?,20-,21?,22+/m1/s1 |
| InChIKey | RWGBTDJRSNWPOK-ZPYGRQMDSA-N |
| XLogP | 4.14 |
| TPSA | 102.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.46 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|