C14H22O3 — CID 135037546
ethyl (3aS,4S,5R,7aR)-3,3,5-trimethyl-3a,4,5,7a-tetrahydro-2H-1-benzofuran-4-carboxylate (PubChem CID 135037546) has the molecular formula C14H22O3 and a molecular weight of 238.33 g/mol. Its IUPAC name is ethyl (3aS,4S,5R,7aR)-3,3,5-trimethyl-3a,4,5,7a-tetrahydro-2H-1-benzofuran-4-carboxylate.
| Compound Name | ethyl (3aS,4S,5R,7aR)-3,3,5-trimethyl-3a,4,5,7a-tetrahydro-2H-1-benzofuran-4-carboxylate |
|---|---|
| PubChem CID | 135037546 |
| Molecular Formula | C14H22O3 |
| Molecular Weight | 238.33 g/mol |
| Exact Mass | 238.16 |
| IUPAC Name | ethyl (3aS,4S,5R,7aR)-3,3,5-trimethyl-3a,4,5,7a-tetrahydro-2H-1-benzofuran-4-carboxylate |
| SMILES | CCOC(=O)[C@@H]1[C@@H]2[C@@H](C=C[C@H]1C)OCC2(C)C |
| InChI | InChI=1S/C14H22O3/c1-5-16-13(15)11-9(2)6-7-10-12(11)14(3,4)8-17-10/h6-7,9-12H,5,8H2,1-4H3/t9-,10-,11+,12+/m1/s1 |
| InChIKey | HHVLCCUORXHFMC-WYUUTHIRSA-N |
| XLogP | 2.41 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.33 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|