C22H32O7 — CID 135038523
methyl (1R,5S,8aS)-2-acetyloxy-5-(3-acetyloxypropyl)-1,5,6-trimethyl-3-oxo-6,7,8,8a-tetrahydro-2H-naphthalene-1-carboxylate (PubChem CID 135038523) has the molecular formula C22H32O7 and a molecular weight of 408.49 g/mol. Its IUPAC name is methyl (1R,5S,8aS)-2-acetyloxy-5-(3-acetyloxypropyl)-1,5,6-trimethyl-3-oxo-6,7,8,8a-tetrahydro-2H-naphthalene-1-carboxylate.
| Compound Name | methyl (1R,5S,8aS)-2-acetyloxy-5-(3-acetyloxypropyl)-1,5,6-trimethyl-3-oxo-6,7,8,8a-tetrahydro-2H-naphthalene-1-carboxylate |
|---|---|
| PubChem CID | 135038523 |
| Molecular Formula | C22H32O7 |
| Molecular Weight | 408.49 g/mol |
| Exact Mass | 408.21 |
| IUPAC Name | methyl (1R,5S,8aS)-2-acetyloxy-5-(3-acetyloxypropyl)-1,5,6-trimethyl-3-oxo-6,7,8,8a-tetrahydro-2H-naphthalene-1-carboxylate |
| SMILES | COC(=O)[C@@]1(C)C(OC(C)=O)C(=O)C=C2[C@@H]1CCC(C)[C@]2(C)CCCOC(C)=O |
| InChI | InChI=1S/C22H32O7/c1-13-8-9-16-17(21(13,4)10-7-11-28-14(2)23)12-18(25)19(29-15(3)24)22(16,5)20(26)27-6/h12-13,16,19H,7-11H2,1-6H3/t13?,16-,19?,21-,22+/m0/s1 |
| InChIKey | UQKIHQQNKYQRNT-ZQYOSAEDSA-N |
| XLogP | 3.00 |
| TPSA | 95.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.49 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|