C15H24O3 — CID 135038649
ethyl (1S,2S,3aR,4R,6aR)-1,3a,4,6a-tetramethyl-5-oxo-2,3,4,6-tetrahydro-1H-pentalene-2-carboxylate (PubChem CID 135038649) has the molecular formula C15H24O3 and a molecular weight of 252.35 g/mol. Its IUPAC name is ethyl (1S,2S,3aR,4R,6aR)-1,3a,4,6a-tetramethyl-5-oxo-2,3,4,6-tetrahydro-1H-pentalene-2-carboxylate.
| Compound Name | ethyl (1S,2S,3aR,4R,6aR)-1,3a,4,6a-tetramethyl-5-oxo-2,3,4,6-tetrahydro-1H-pentalene-2-carboxylate |
|---|---|
| PubChem CID | 135038649 |
| Molecular Formula | C15H24O3 |
| Molecular Weight | 252.35 g/mol |
| Exact Mass | 252.17 |
| IUPAC Name | ethyl (1S,2S,3aR,4R,6aR)-1,3a,4,6a-tetramethyl-5-oxo-2,3,4,6-tetrahydro-1H-pentalene-2-carboxylate |
| SMILES | CCOC(=O)[C@H]1C[C@]2(C)[C@@H](C)C(=O)C[C@]2(C)[C@H]1C |
| InChI | InChI=1S/C15H24O3/c1-6-18-13(17)11-7-14(4)10(3)12(16)8-15(14,5)9(11)2/h9-11H,6-8H2,1-5H3/t9-,10-,11-,14+,15+/m0/s1 |
| InChIKey | HABWAHSXAMBJJD-LYEQHPFYSA-N |
| XLogP | 2.83 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.35 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |