C12H22O3 — CID 135039824
(4R,6E,8S,10E)-dodeca-6,10-diene-1,4,8-triol (PubChem CID 135039824) has the molecular formula C12H22O3 and a molecular weight of 214.31 g/mol. Its IUPAC name is (4R,6E,8S,10E)-dodeca-6,10-diene-1,4,8-triol.
| Compound Name | (4R,6E,8S,10E)-dodeca-6,10-diene-1,4,8-triol |
|---|---|
| PubChem CID | 135039824 |
| Molecular Formula | C12H22O3 |
| Molecular Weight | 214.31 g/mol |
| Exact Mass | 214.16 |
| IUPAC Name | (4R,6E,8S,10E)-dodeca-6,10-diene-1,4,8-triol |
| SMILES | C/C=C/C[C@H](O)/C=C/C[C@H](O)CCCO |
| InChI | InChI=1S/C12H22O3/c1-2-3-6-11(14)7-4-8-12(15)9-5-10-13/h2-4,7,11-15H,5-6,8-10H2,1H3/b3-2+,7-4+/t11-,12-/m0/s1 |
| InChIKey | XYRFSTXTZZLEJP-LUFSUZLSSA-N |
| XLogP | 1.39 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.31 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|