C9H16O4S — CID 135039955
(3R,4aS,7R,8aS)-3-methyl-1,1-dioxo-3,4,4a,5,6,7,8,8a-octahydrobenzo[c]oxathiin-7-ol (PubChem CID 135039955) has the molecular formula C9H16O4S and a molecular weight of 220.29 g/mol. Its IUPAC name is (3R,4aS,7R,8aS)-3-methyl-1,1-dioxo-3,4,4a,5,6,7,8,8a-octahydrobenzo[c]oxathiin-7-ol.
| Compound Name | (3R,4aS,7R,8aS)-3-methyl-1,1-dioxo-3,4,4a,5,6,7,8,8a-octahydrobenzo[c]oxathiin-7-ol |
|---|---|
| PubChem CID | 135039955 |
| Molecular Formula | C9H16O4S |
| Molecular Weight | 220.29 g/mol |
| Exact Mass | 220.08 |
| IUPAC Name | (3R,4aS,7R,8aS)-3-methyl-1,1-dioxo-3,4,4a,5,6,7,8,8a-octahydrobenzo[c]oxathiin-7-ol |
| SMILES | C[C@@H]1C[C@@H]2CC[C@@H](O)C[C@@H]2S(=O)(=O)O1 |
| InChI | InChI=1S/C9H16O4S/c1-6-4-7-2-3-8(10)5-9(7)14(11,12)13-6/h6-10H,2-5H2,1H3/t6-,7+,8-,9+/m1/s1 |
| InChIKey | FSYFQYYQWXNCTK-XAVMHZPKSA-N |
| XLogP | 0.65 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.29 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|