C16H24O2 — CID 135040343
(2E,5E)-5-methyl-6-[(2S,6S)-4-methylidene-6-prop-2-enyloxan-2-yl]hexa-2,5-dien-1-ol (PubChem CID 135040343) has the molecular formula C16H24O2 and a molecular weight of 248.37 g/mol. Its IUPAC name is (2E,5E)-5-methyl-6-[(2S,6S)-4-methylidene-6-prop-2-enyloxan-2-yl]hexa-2,5-dien-1-ol.
| Compound Name | (2E,5E)-5-methyl-6-[(2S,6S)-4-methylidene-6-prop-2-enyloxan-2-yl]hexa-2,5-dien-1-ol |
|---|---|
| PubChem CID | 135040343 |
| Molecular Formula | C16H24O2 |
| Molecular Weight | 248.37 g/mol |
| Exact Mass | 248.18 |
| IUPAC Name | (2E,5E)-5-methyl-6-[(2S,6S)-4-methylidene-6-prop-2-enyloxan-2-yl]hexa-2,5-dien-1-ol |
| SMILES | C=CC[C@H]1CC(=C)C[C@@H](/C=C(\C)C/C=C/CO)O1 |
| InChI | InChI=1S/C16H24O2/c1-4-7-15-11-14(3)12-16(18-15)10-13(2)8-5-6-9-17/h4-6,10,15-17H,1,3,7-9,11-12H2,2H3/b6-5+,13-10+/t15-,16+/m0/s1 |
| InChIKey | DRUSZUJLZAURBQ-KGEZVKJZSA-N |
| XLogP | 3.55 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.37 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|