C14H30O4Si — CID 135041140
(2S,3S,4S)-4-[tert-butyl(dimethyl)silyl]oxy-2,3-dihydroxyoctanal (PubChem CID 135041140) has the molecular formula C14H30O4Si and a molecular weight of 290.48 g/mol. Its IUPAC name is (2S,3S,4S)-4-[tert-butyl(dimethyl)silyl]oxy-2,3-dihydroxyoctanal.
| Compound Name | (2S,3S,4S)-4-[tert-butyl(dimethyl)silyl]oxy-2,3-dihydroxyoctanal |
|---|---|
| PubChem CID | 135041140 |
| Molecular Formula | C14H30O4Si |
| Molecular Weight | 290.48 g/mol |
| Exact Mass | 290.19 |
| IUPAC Name | (2S,3S,4S)-4-[tert-butyl(dimethyl)silyl]oxy-2,3-dihydroxyoctanal |
| SMILES | CCCC[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H](O)C=O |
| InChI | InChI=1S/C14H30O4Si/c1-7-8-9-12(13(17)11(16)10-15)18-19(5,6)14(2,3)4/h10-13,16-17H,7-9H2,1-6H3/t11-,12+,13+/m1/s1 |
| InChIKey | WFUIJOSXZNSTAU-AGIUHOORSA-N |
| XLogP | 2.49 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.48 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|