C13H17NO3 — CID 135041379
ethyl (3aR,4S,7aS)-7a-cyano-1-oxo-3,3a,4,5,6,7-hexahydro-2H-indene-4-carboxylate (PubChem CID 135041379) has the molecular formula C13H17NO3 and a molecular weight of 235.28 g/mol. Its IUPAC name is ethyl (3aR,4S,7aS)-7a-cyano-1-oxo-3,3a,4,5,6,7-hexahydro-2H-indene-4-carboxylate.
| Compound Name | ethyl (3aR,4S,7aS)-7a-cyano-1-oxo-3,3a,4,5,6,7-hexahydro-2H-indene-4-carboxylate |
|---|---|
| PubChem CID | 135041379 |
| Molecular Formula | C13H17NO3 |
| Molecular Weight | 235.28 g/mol |
| Exact Mass | 235.12 |
| IUPAC Name | ethyl (3aR,4S,7aS)-7a-cyano-1-oxo-3,3a,4,5,6,7-hexahydro-2H-indene-4-carboxylate |
| SMILES | CCOC(=O)[C@H]1CCC[C@]2(C#N)C(=O)CC[C@H]12 |
| InChI | InChI=1S/C13H17NO3/c1-2-17-12(16)9-4-3-7-13(8-14)10(9)5-6-11(13)15/h9-10H,2-7H2,1H3/t9-,10+,13+/m0/s1 |
| InChIKey | NBNARGHIUURRNV-OPQQBVKSSA-N |
| XLogP | 1.84 |
| TPSA | 67.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.28 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |