C13H17NO3 — CID 51055178
[(1R,3aR,4S,7aS)-1-cyano-7a-methyl-3-oxo-2,3a,4,5,6,7-hexahydro-1H-inden-4-yl] acetate (PubChem CID 51055178) has the molecular formula C13H17NO3 and a molecular weight of 235.28 g/mol. Its IUPAC name is [(1R,3aR,4S,7aS)-1-cyano-7a-methyl-3-oxo-2,3a,4,5,6,7-hexahydro-1H-inden-4-yl] acetate.
| Compound Name | [(1R,3aR,4S,7aS)-1-cyano-7a-methyl-3-oxo-2,3a,4,5,6,7-hexahydro-1H-inden-4-yl] acetate |
|---|---|
| PubChem CID | 51055178 |
| Molecular Formula | C13H17NO3 |
| Molecular Weight | 235.28 g/mol |
| Exact Mass | 235.12 |
| IUPAC Name | [(1R,3aR,4S,7aS)-1-cyano-7a-methyl-3-oxo-2,3a,4,5,6,7-hexahydro-1H-inden-4-yl] acetate |
| SMILES | CC(=O)O[C@H]1CCC[C@@]2(C)[C@H](C#N)CC(=O)[C@@H]12 |
| InChI | InChI=1S/C13H17NO3/c1-8(15)17-11-4-3-5-13(2)9(7-14)6-10(16)12(11)13/h9,11-12H,3-6H2,1-2H3/t9-,11-,12-,13-/m0/s1 |
| InChIKey | RZWCHEPTORBANE-BQUFFADESA-N |
| XLogP | 1.84 |
| TPSA | 67.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.28 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |