About methyl 3-[(1R,2S)-2-cyano-1-methyl-5-oxocyclopentyl]propanoate
methyl 3-[(1R,2S)-2-cyano-1-methyl-5-oxocyclopentyl]propanoate (PubChem CID 10987512) has the molecular formula C11H15NO3
and a molecular weight of 209.24 g/mol. Its IUPAC name is methyl 3-[(1R,2S)-2-cyano-1-methyl-5-oxocyclopentyl]propanoate.
Analyze methyl 3-[(1R,2S)-2-cyano-1-methyl-5-oxocyclopentyl]propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 3-[(1R,2S)-2-cyano-1-methyl-5-oxocyclopentyl]propanoate?
The IUPAC name of methyl 3-[(1R,2S)-2-cyano-1-methyl-5-oxocyclopentyl]propanoate (CID 10987512) is methyl 3-[(1R,2S)-2-cyano-1-methyl-5-oxocyclopentyl]propanoate.
What is the SMILES notation for methyl 3-[(1R,2S)-2-cyano-1-methyl-5-oxocyclopentyl]propanoate?
The canonical SMILES for methyl 3-[(1R,2S)-2-cyano-1-methyl-5-oxocyclopentyl]propanoate is COC(=O)CC[C@@]1(C)C(=O)CC[C@@H]1C#N.
What is the InChIKey of methyl 3-[(1R,2S)-2-cyano-1-methyl-5-oxocyclopentyl]propanoate?
The InChIKey is RHCWZEXNUYCPTB-LDYMZIIASA-N. The full InChI is InChI=1S/C11H15NO3/c1-11(6-5-10(14)15-2)8(7-12)3-4-9(11)13/h8H,3-6H2,1-2H3/t8-,11-/m1/s1.
What are the key properties of methyl 3-[(1R,2S)-2-cyano-1-methyl-5-oxocyclopentyl]propanoate?
methyl 3-[(1R,2S)-2-cyano-1-methyl-5-oxocyclopentyl]propanoate has a molecular weight of 209.24 g/mol, XLogP of 1.45, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-[(1R,2S)-2-cyano-1-methyl-5-oxocyclopentyl]propanoate is sourced from PubChem (CID 10987512), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).