C14H19NO3 — CID 164889746
methyl 2-[(1R,2R,3aR,6aR)-1-cyano-1,2-dimethyl-6-oxo-3,4,5,6a-tetrahydro-2H-pentalen-3a-yl]acetate (PubChem CID 164889746) has the molecular formula C14H19NO3 and a molecular weight of 249.31 g/mol. Its IUPAC name is methyl 2-[(1R,2R,3aR,6aR)-1-cyano-1,2-dimethyl-6-oxo-3,4,5,6a-tetrahydro-2H-pentalen-3a-yl]acetate.
| Compound Name | methyl 2-[(1R,2R,3aR,6aR)-1-cyano-1,2-dimethyl-6-oxo-3,4,5,6a-tetrahydro-2H-pentalen-3a-yl]acetate |
|---|---|
| PubChem CID | 164889746 |
| Molecular Formula | C14H19NO3 |
| Molecular Weight | 249.31 g/mol |
| Exact Mass | 249.14 |
| IUPAC Name | methyl 2-[(1R,2R,3aR,6aR)-1-cyano-1,2-dimethyl-6-oxo-3,4,5,6a-tetrahydro-2H-pentalen-3a-yl]acetate |
| SMILES | COC(=O)C[C@]12CCC(=O)[C@H]1[C@](C)(C#N)[C@H](C)C2 |
| InChI | InChI=1S/C14H19NO3/c1-9-6-14(7-11(17)18-3)5-4-10(16)12(14)13(9,2)8-15/h9,12H,4-7H2,1-3H3/t9-,12+,13-,14-/m1/s1 |
| InChIKey | DPTSEHUNAHYFGR-GJQVQUKXSA-N |
| XLogP | 2.08 |
| TPSA | 67.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.31 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |