C15H21NO3 — CID 164889797
methyl 2-[(3aS,6R,7R,7aR)-7-cyano-6,7-dimethyl-1-oxo-2,3,4,5,6,7a-hexahydroinden-3a-yl]acetate (PubChem CID 164889797) has the molecular formula C15H21NO3 and a molecular weight of 263.34 g/mol. Its IUPAC name is methyl 2-[(3aS,6R,7R,7aR)-7-cyano-6,7-dimethyl-1-oxo-2,3,4,5,6,7a-hexahydroinden-3a-yl]acetate.
| Compound Name | methyl 2-[(3aS,6R,7R,7aR)-7-cyano-6,7-dimethyl-1-oxo-2,3,4,5,6,7a-hexahydroinden-3a-yl]acetate |
|---|---|
| PubChem CID | 164889797 |
| Molecular Formula | C15H21NO3 |
| Molecular Weight | 263.34 g/mol |
| Exact Mass | 263.15 |
| IUPAC Name | methyl 2-[(3aS,6R,7R,7aR)-7-cyano-6,7-dimethyl-1-oxo-2,3,4,5,6,7a-hexahydroinden-3a-yl]acetate |
| SMILES | COC(=O)C[C@]12CCC(=O)[C@H]1[C@](C)(C#N)[C@H](C)CC2 |
| InChI | InChI=1S/C15H21NO3/c1-10-4-6-15(8-12(18)19-3)7-5-11(17)13(15)14(10,2)9-16/h10,13H,4-8H2,1-3H3/t10-,13+,14-,15+/m1/s1 |
| InChIKey | BZTRURKNJFXZIS-KAOXEZKKSA-N |
| XLogP | 2.47 |
| TPSA | 67.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.34 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |