C16H23NO3 — CID 164889843
methyl 2-[(3aR,5S,6R,7R,7aR)-7-cyano-5,6,7-trimethyl-1-oxo-2,3,4,5,6,7a-hexahydroinden-3a-yl]acetate (PubChem CID 164889843) has the molecular formula C16H23NO3 and a molecular weight of 277.36 g/mol. Its IUPAC name is methyl 2-[(3aR,5S,6R,7R,7aR)-7-cyano-5,6,7-trimethyl-1-oxo-2,3,4,5,6,7a-hexahydroinden-3a-yl]acetate.
| Compound Name | methyl 2-[(3aR,5S,6R,7R,7aR)-7-cyano-5,6,7-trimethyl-1-oxo-2,3,4,5,6,7a-hexahydroinden-3a-yl]acetate |
|---|---|
| PubChem CID | 164889843 |
| Molecular Formula | C16H23NO3 |
| Molecular Weight | 277.36 g/mol |
| Exact Mass | 277.17 |
| IUPAC Name | methyl 2-[(3aR,5S,6R,7R,7aR)-7-cyano-5,6,7-trimethyl-1-oxo-2,3,4,5,6,7a-hexahydroinden-3a-yl]acetate |
| SMILES | COC(=O)C[C@]12CCC(=O)[C@H]1[C@](C)(C#N)[C@H](C)[C@@H](C)C2 |
| InChI | InChI=1S/C16H23NO3/c1-10-7-16(8-13(19)20-4)6-5-12(18)14(16)15(3,9-17)11(10)2/h10-11,14H,5-8H2,1-4H3/t10-,11+,14-,15+,16+/m0/s1 |
| InChIKey | FTLKSJUFXOTDCO-GRIRQICOSA-N |
| XLogP | 2.72 |
| TPSA | 67.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.36 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |