C15H25NO4 — CID 135043356
tert-butyl (3aS,8Z,9aR)-2,2-dimethyl-4,6,7,9a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]azocine-5-carboxylate (PubChem CID 135043356) has the molecular formula C15H25NO4 and a molecular weight of 283.37 g/mol. Its IUPAC name is tert-butyl (3aS,8Z,9aR)-2,2-dimethyl-4,6,7,9a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]azocine-5-carboxylate.
| Compound Name | tert-butyl (3aS,8Z,9aR)-2,2-dimethyl-4,6,7,9a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]azocine-5-carboxylate |
|---|---|
| PubChem CID | 135043356 |
| Molecular Formula | C15H25NO4 |
| Molecular Weight | 283.37 g/mol |
| Exact Mass | 283.18 |
| IUPAC Name | tert-butyl (3aS,8Z,9aR)-2,2-dimethyl-4,6,7,9a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]azocine-5-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC/C=C\[C@H]2OC(C)(C)O[C@H]2C1 |
| InChI | InChI=1S/C15H25NO4/c1-14(2,3)20-13(17)16-9-7-6-8-11-12(10-16)19-15(4,5)18-11/h6,8,11-12H,7,9-10H2,1-5H3/b8-6-/t11-,12+/m1/s1 |
| InChIKey | WJMAVZZTEABYHH-YYYFKNSJSA-N |
| XLogP | 2.70 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.37 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|