C41H77NO7Si3 — CID 135043550
(4R)-4-benzyl-3-[(2R,3S,5R,6R,8R)-3,9-bis[[tert-butyl(dimethyl)silyl]oxy]-6-methoxy-2,6,8-trimethyl-5-triethylsilyloxynonanoyl]-1,3-oxazolidin-2-one (PubChem CID 135043550) has the molecular formula C41H77NO7Si3 and a molecular weight of 780.32 g/mol. Its IUPAC name is (4R)-4-benzyl-3-[(2R,3S,5R,6R,8R)-3,9-bis[[tert-butyl(dimethyl)silyl]oxy]-6-methoxy-2,6,8-trimethyl-5-triethylsilyloxynonanoyl]-1,3-oxazolidin-2-one.
| Compound Name | (4R)-4-benzyl-3-[(2R,3S,5R,6R,8R)-3,9-bis[[tert-butyl(dimethyl)silyl]oxy]-6-methoxy-2,6,8-trimethyl-5-triethylsilyloxynonanoyl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 135043550 |
| Molecular Formula | C41H77NO7Si3 |
| Molecular Weight | 780.32 g/mol |
| Exact Mass | 779.50 |
| IUPAC Name | (4R)-4-benzyl-3-[(2R,3S,5R,6R,8R)-3,9-bis[[tert-butyl(dimethyl)silyl]oxy]-6-methoxy-2,6,8-trimethyl-5-triethylsilyloxynonanoyl]-1,3-oxazolidin-2-one |
| SMILES | CC[Si](CC)(CC)O[C@H](C[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](C)C(=O)N1C(=O)OC[C@H]1Cc1ccccc1)[C@@](C)(C[C@@H](C)CO[Si](C)(C)C(C)(C)C)OC |
| InChI | InChI=1S/C41H77NO7Si3/c1-18-52(19-2,20-3)49-36(41(12,45-13)28-31(4)29-47-50(14,15)39(6,7)8)27-35(48-51(16,17)40(9,10)11)32(5)37(43)42-34(30-46-38(42)44)26-33-24-22-21-23-25-33/h21-25,31-32,34-36H,18-20,26-30H2,1-17H3/t31-,32-,34-,35+,36-,41-/m1/s1 |
| InChIKey | VCSOFYHMWVVMKF-VDUMYCOESA-N |
| XLogP | 10.84 |
| TPSA | 83.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 780.32 |
| LogP ≤ 5 | 10.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|