C8H10N2O2 — CID 135043769
2-[(2S)-1,4-dioxan-2-yl]pyrazine (PubChem CID 135043769) has the molecular formula C8H10N2O2 and a molecular weight of 166.18 g/mol. Its IUPAC name is 2-[(2S)-1,4-dioxan-2-yl]pyrazine.
| Compound Name | 2-[(2S)-1,4-dioxan-2-yl]pyrazine |
|---|---|
| PubChem CID | 135043769 |
| Molecular Formula | C8H10N2O2 |
| Molecular Weight | 166.18 g/mol |
| Exact Mass | 166.07 |
| IUPAC Name | 2-[(2S)-1,4-dioxan-2-yl]pyrazine |
| SMILES | c1cnc([C@H]2COCCO2)cn1 |
| InChI | InChI=1S/C8H10N2O2/c1-2-10-7(5-9-1)8-6-11-3-4-12-8/h1-2,5,8H,3-4,6H2/t8-/m1/s1 |
| InChIKey | PUNSTEVWRHMXFZ-MRVPVSSYSA-N |
| XLogP | 0.56 |
| TPSA | 44.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.18 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |