C10H14N2O2 — CID 135044773
5-[(2S)-1,4-dioxan-2-yl]-2,3-dimethylpyrazine (PubChem CID 135044773) has the molecular formula C10H14N2O2 and a molecular weight of 194.23 g/mol. Its IUPAC name is 5-[(2S)-1,4-dioxan-2-yl]-2,3-dimethylpyrazine.
| Compound Name | 5-[(2S)-1,4-dioxan-2-yl]-2,3-dimethylpyrazine |
|---|---|
| PubChem CID | 135044773 |
| Molecular Formula | C10H14N2O2 |
| Molecular Weight | 194.23 g/mol |
| Exact Mass | 194.11 |
| IUPAC Name | 5-[(2S)-1,4-dioxan-2-yl]-2,3-dimethylpyrazine |
| SMILES | Cc1ncc([C@H]2COCCO2)nc1C |
| InChI | InChI=1S/C10H14N2O2/c1-7-8(2)12-9(5-11-7)10-6-13-3-4-14-10/h5,10H,3-4,6H2,1-2H3/t10-/m1/s1 |
| InChIKey | XDWZOLZLWILHME-SNVBAGLBSA-N |
| XLogP | 1.18 |
| TPSA | 44.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.23 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |