C11H10N2O3 — CID 57268529
[5-(pyrazin-2-ylmethoxy)-2,5-dihydropyran-6-ylidene]methanone (PubChem CID 57268529) has the molecular formula C11H10N2O3 and a molecular weight of 218.21 g/mol. Its IUPAC name is [5-(pyrazin-2-ylmethoxy)-2,5-dihydropyran-6-ylidene]methanone.
| Compound Name | [5-(pyrazin-2-ylmethoxy)-2,5-dihydropyran-6-ylidene]methanone |
|---|---|
| PubChem CID | 57268529 |
| Molecular Formula | C11H10N2O3 |
| Molecular Weight | 218.21 g/mol |
| Exact Mass | 218.07 |
| IUPAC Name | [5-(pyrazin-2-ylmethoxy)-2,5-dihydropyran-6-ylidene]methanone |
| SMILES | O=C=C1OCC=CC1OCc1cnccn1 |
| InChI | InChI=1S/C11H10N2O3/c14-7-11-10(2-1-5-15-11)16-8-9-6-12-3-4-13-9/h1-4,6,10H,5,8H2 |
| InChIKey | RYXLOBWMYRPYBJ-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 61.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.21 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'ketene', 'substructure': 'N/A'} |
|---|