C19H28O2SSi — CID 135045883
(Z,4R)-4-[tert-butyl(dimethyl)silyl]oxy-4-methyl-3-phenylsulfanylhex-2-en-5-yn-1-ol (PubChem CID 135045883) has the molecular formula C19H28O2SSi and a molecular weight of 348.58 g/mol. Its IUPAC name is (Z,4R)-4-[tert-butyl(dimethyl)silyl]oxy-4-methyl-3-phenylsulfanylhex-2-en-5-yn-1-ol.
| Compound Name | (Z,4R)-4-[tert-butyl(dimethyl)silyl]oxy-4-methyl-3-phenylsulfanylhex-2-en-5-yn-1-ol |
|---|---|
| PubChem CID | 135045883 |
| Molecular Formula | C19H28O2SSi |
| Molecular Weight | 348.58 g/mol |
| Exact Mass | 348.16 |
| IUPAC Name | (Z,4R)-4-[tert-butyl(dimethyl)silyl]oxy-4-methyl-3-phenylsulfanylhex-2-en-5-yn-1-ol |
| SMILES | C#C[C@@](C)(O[Si](C)(C)C(C)(C)C)/C(=C/CO)Sc1ccccc1 |
| InChI | InChI=1S/C19H28O2SSi/c1-8-19(5,21-23(6,7)18(2,3)4)17(14-15-20)22-16-12-10-9-11-13-16/h1,9-14,20H,15H2,2-7H3/b17-14-/t19-/m1/s1 |
| InChIKey | MVGWSIKZRTYLPN-RBAUTDOXSA-N |
| XLogP | 5.07 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.58 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|