C20H34O2SSi — CID 134920793
(E,2R,3R)-2-[tert-butyl(dimethyl)silyl]oxy-6-methyl-4-phenylsulfanylhept-4-en-3-ol (PubChem CID 134920793) has the molecular formula C20H34O2SSi and a molecular weight of 366.64 g/mol. Its IUPAC name is (E,2R,3R)-2-[tert-butyl(dimethyl)silyl]oxy-6-methyl-4-phenylsulfanylhept-4-en-3-ol.
| Compound Name | (E,2R,3R)-2-[tert-butyl(dimethyl)silyl]oxy-6-methyl-4-phenylsulfanylhept-4-en-3-ol |
|---|---|
| PubChem CID | 134920793 |
| Molecular Formula | C20H34O2SSi |
| Molecular Weight | 366.64 g/mol |
| Exact Mass | 366.20 |
| IUPAC Name | (E,2R,3R)-2-[tert-butyl(dimethyl)silyl]oxy-6-methyl-4-phenylsulfanylhept-4-en-3-ol |
| SMILES | CC(C)/C=C(/Sc1ccccc1)[C@H](O)[C@@H](C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C20H34O2SSi/c1-15(2)14-18(23-17-12-10-9-11-13-17)19(21)16(3)22-24(7,8)20(4,5)6/h9-16,19,21H,1-8H3/b18-14+/t16-,19-/m1/s1 |
| InChIKey | KBEQKJAHHLQFQC-PUZOFKTQSA-N |
| XLogP | 6.09 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.64 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|