C21H36O3SSi — CID 134933015
(E,2S,3R)-2-[tert-butyl(dimethyl)silyl]oxy-6-methyl-4-[(S)-(4-methylphenyl)sulfinyl]hept-4-en-3-ol (PubChem CID 134933015) has the molecular formula C21H36O3SSi and a molecular weight of 396.67 g/mol. Its IUPAC name is (E,2S,3R)-2-[tert-butyl(dimethyl)silyl]oxy-6-methyl-4-[(S)-(4-methylphenyl)sulfinyl]hept-4-en-3-ol.
| Compound Name | (E,2S,3R)-2-[tert-butyl(dimethyl)silyl]oxy-6-methyl-4-[(S)-(4-methylphenyl)sulfinyl]hept-4-en-3-ol |
|---|---|
| PubChem CID | 134933015 |
| Molecular Formula | C21H36O3SSi |
| Molecular Weight | 396.67 g/mol |
| Exact Mass | 396.22 |
| IUPAC Name | (E,2S,3R)-2-[tert-butyl(dimethyl)silyl]oxy-6-methyl-4-[(S)-(4-methylphenyl)sulfinyl]hept-4-en-3-ol |
| SMILES | Cc1ccc([S@](=O)/C(=C/C(C)C)[C@H](O)[C@H](C)O[Si](C)(C)C(C)(C)C)cc1 |
| InChI | InChI=1S/C21H36O3SSi/c1-15(2)14-19(25(23)18-12-10-16(3)11-13-18)20(22)17(4)24-26(8,9)21(5,6)7/h10-15,17,20,22H,1-9H3/b19-14+/t17-,20+,25-/m0/s1 |
| InChIKey | QDCUXRMXVNILEV-OZWOCWKDSA-N |
| XLogP | 5.41 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.67 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|