C15H22O6 — CID 135047804
methyl (E)-3-hydroxy-3-methoxy-2-[(7-methyl-1,4-dioxaspiro[4.5]dec-7-en-8-yl)methyl]prop-2-enoate (PubChem CID 135047804) has the molecular formula C15H22O6 and a molecular weight of 298.33 g/mol. Its IUPAC name is methyl (E)-3-hydroxy-3-methoxy-2-[(7-methyl-1,4-dioxaspiro[4.5]dec-7-en-8-yl)methyl]prop-2-enoate.
| Compound Name | methyl (E)-3-hydroxy-3-methoxy-2-[(7-methyl-1,4-dioxaspiro[4.5]dec-7-en-8-yl)methyl]prop-2-enoate |
|---|---|
| PubChem CID | 135047804 |
| Molecular Formula | C15H22O6 |
| Molecular Weight | 298.33 g/mol |
| Exact Mass | 298.14 |
| IUPAC Name | methyl (E)-3-hydroxy-3-methoxy-2-[(7-methyl-1,4-dioxaspiro[4.5]dec-7-en-8-yl)methyl]prop-2-enoate |
| SMILES | COC(=O)/C(CC1=C(C)CC2(CC1)OCCO2)=C(\O)OC |
| InChI | InChI=1S/C15H22O6/c1-10-9-15(20-6-7-21-15)5-4-11(10)8-12(13(16)18-2)14(17)19-3/h16H,4-9H2,1-3H3/b13-12+ |
| InChIKey | JACHJRITTHRMFF-OUKQBFOZSA-N |
| XLogP | 2.21 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.33 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|