C10H13N3O3 — CID 10966122
7-methyl-1,4-dioxaspiro[4.5]dec-7-ene-8-carbonyl azide (PubChem CID 10966122) has the molecular formula C10H13N3O3 and a molecular weight of 223.23 g/mol. Its IUPAC name is 7-methyl-1,4-dioxaspiro[4.5]dec-7-ene-8-carbonyl azide.
| Compound Name | 7-methyl-1,4-dioxaspiro[4.5]dec-7-ene-8-carbonyl azide |
|---|---|
| PubChem CID | 10966122 |
| Molecular Formula | C10H13N3O3 |
| Molecular Weight | 223.23 g/mol |
| Exact Mass | 223.10 |
| IUPAC Name | 7-methyl-1,4-dioxaspiro[4.5]dec-7-ene-8-carbonyl azide |
| SMILES | CC1=C(C(=O)N=[N+]=[N-])CCC2(C1)OCCO2 |
| InChI | InChI=1S/C10H13N3O3/c1-7-6-10(15-4-5-16-10)3-2-8(7)9(14)12-13-11/h2-6H2,1H3 |
| InChIKey | WIPYJXJZIITHBA-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 84.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.23 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|