C22H25N3O7 — CID 11762033
8-[6-(oxan-2-yloxymethyl)-1,3-benzodioxol-5-yl]-1,4-dioxaspiro[4.5]dec-7-ene-7-carbonyl azide (PubChem CID 11762033) has the molecular formula C22H25N3O7 and a molecular weight of 443.46 g/mol. Its IUPAC name is 8-[6-(oxan-2-yloxymethyl)-1,3-benzodioxol-5-yl]-1,4-dioxaspiro[4.5]dec-7-ene-7-carbonyl azide.
| Compound Name | 8-[6-(oxan-2-yloxymethyl)-1,3-benzodioxol-5-yl]-1,4-dioxaspiro[4.5]dec-7-ene-7-carbonyl azide |
|---|---|
| PubChem CID | 11762033 |
| Molecular Formula | C22H25N3O7 |
| Molecular Weight | 443.46 g/mol |
| Exact Mass | 443.17 |
| IUPAC Name | 8-[6-(oxan-2-yloxymethyl)-1,3-benzodioxol-5-yl]-1,4-dioxaspiro[4.5]dec-7-ene-7-carbonyl azide |
| SMILES | [N-]=[N+]=NC(=O)C1=C(c2cc3c(cc2COC2CCCCO2)OCO3)CCC2(C1)OCCO2 |
| InChI | InChI=1S/C22H25N3O7/c23-25-24-21(26)17-11-22(31-7-8-32-22)5-4-15(17)16-10-19-18(29-13-30-19)9-14(16)12-28-20-3-1-2-6-27-20/h9-10,20H,1-8,11-13H2 |
| InChIKey | GQQPXDCYMBDNCK-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 121.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.46 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|