About methyl (8-oxo-1,4-dioxaspiro[4.5]decan-7-yl) carbonate
methyl (8-oxo-1,4-dioxaspiro[4.5]decan-7-yl) carbonate (PubChem CID 134867325) has the molecular formula C10H14O6
and a molecular weight of 230.22 g/mol. Its IUPAC name is methyl (8-oxo-1,4-dioxaspiro[4.5]decan-7-yl) carbonate.
Analyze methyl (8-oxo-1,4-dioxaspiro[4.5]decan-7-yl) carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl (8-oxo-1,4-dioxaspiro[4.5]decan-7-yl) carbonate?
The IUPAC name of methyl (8-oxo-1,4-dioxaspiro[4.5]decan-7-yl) carbonate (CID 134867325) is methyl (8-oxo-1,4-dioxaspiro[4.5]decan-7-yl) carbonate.
What is the SMILES notation for methyl (8-oxo-1,4-dioxaspiro[4.5]decan-7-yl) carbonate?
The canonical SMILES for methyl (8-oxo-1,4-dioxaspiro[4.5]decan-7-yl) carbonate is COC(=O)OC1CC2(CCC1=O)OCCO2.
What is the InChIKey of methyl (8-oxo-1,4-dioxaspiro[4.5]decan-7-yl) carbonate?
The InChIKey is GGTVZEPKZONDRA-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14O6/c1-13-9(12)16-8-6-10(3-2-7(8)11)14-4-5-15-10/h8H,2-6H2,1H3.
What are the key properties of methyl (8-oxo-1,4-dioxaspiro[4.5]decan-7-yl) carbonate?
methyl (8-oxo-1,4-dioxaspiro[4.5]decan-7-yl) carbonate has a molecular weight of 230.22 g/mol, XLogP of 0.63, 1 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (8-oxo-1,4-dioxaspiro[4.5]decan-7-yl) carbonate is sourced from PubChem (CID 134867325), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).