C10H12F2O4 — CID 165484261
7-(2,2-difluoroacetyl)-1,4-dioxaspiro[4.5]decan-8-one (PubChem CID 165484261) has the molecular formula C10H12F2O4 and a molecular weight of 234.20 g/mol. Its IUPAC name is 7-(2,2-difluoroacetyl)-1,4-dioxaspiro[4.5]decan-8-one.
| Compound Name | 7-(2,2-difluoroacetyl)-1,4-dioxaspiro[4.5]decan-8-one |
|---|---|
| PubChem CID | 165484261 |
| Molecular Formula | C10H12F2O4 |
| Molecular Weight | 234.20 g/mol |
| Exact Mass | 234.07 |
| IUPAC Name | 7-(2,2-difluoroacetyl)-1,4-dioxaspiro[4.5]decan-8-one |
| SMILES | O=C1CCC2(CC1C(=O)C(F)F)OCCO2 |
| InChI | InChI=1S/C10H12F2O4/c11-9(12)8(14)6-5-10(2-1-7(6)13)15-3-4-16-10/h6,9H,1-5H2 |
| InChIKey | CWCIAWBLQIWALX-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.20 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|