About 7-(4-chlorobutyl)-1,4-dioxaspiro[4.5]decan-8-one
7-(4-chlorobutyl)-1,4-dioxaspiro[4.5]decan-8-one (PubChem CID 121003180) has the molecular formula C12H19ClO3
and a molecular weight of 246.73 g/mol. Its IUPAC name is 7-(4-chlorobutyl)-1,4-dioxaspiro[4.5]decan-8-one.
Molecular Properties
| Compound Name | 7-(4-chlorobutyl)-1,4-dioxaspiro[4.5]decan-8-one |
| PubChem CID | 121003180 |
| Molecular Formula | C12H19ClO3 |
| Molecular Weight | 246.73 g/mol |
| Exact Mass | 246.10 |
| IUPAC Name | 7-(4-chlorobutyl)-1,4-dioxaspiro[4.5]decan-8-one |
| SMILES | O=C1CCC2(CC1CCCCCl)OCCO2 |
| InChI | InChI=1S/C12H19ClO3/c13-6-2-1-3-10-9-12(5-4-11(10)14)15-7-8-16-12/h10H,1-9H2 |
| InChIKey | KZWYNYZEGZKWGE-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.73 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 7-(4-chlorobutyl)-1,4-dioxaspiro[4.5]decan-8-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-(4-chlorobutyl)-1,4-dioxaspiro[4.5]decan-8-one?
The IUPAC name of 7-(4-chlorobutyl)-1,4-dioxaspiro[4.5]decan-8-one (CID 121003180) is 7-(4-chlorobutyl)-1,4-dioxaspiro[4.5]decan-8-one.
What is the SMILES notation for 7-(4-chlorobutyl)-1,4-dioxaspiro[4.5]decan-8-one?
The canonical SMILES for 7-(4-chlorobutyl)-1,4-dioxaspiro[4.5]decan-8-one is O=C1CCC2(CC1CCCCCl)OCCO2.
What is the InChIKey of 7-(4-chlorobutyl)-1,4-dioxaspiro[4.5]decan-8-one?
The InChIKey is KZWYNYZEGZKWGE-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H19ClO3/c13-6-2-1-3-10-9-12(5-4-11(10)14)15-7-8-16-12/h10H,1-9H2.
What are the key properties of 7-(4-chlorobutyl)-1,4-dioxaspiro[4.5]decan-8-one?
7-(4-chlorobutyl)-1,4-dioxaspiro[4.5]decan-8-one has a molecular weight of 246.73 g/mol, XLogP of 2.51, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7-(4-chlorobutyl)-1,4-dioxaspiro[4.5]decan-8-one is sourced from PubChem (CID 121003180), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).