About 7-sulfanyl-1,4-dioxaspiro[4.5]decan-8-one
7-sulfanyl-1,4-dioxaspiro[4.5]decan-8-one (PubChem CID 87163817) has the molecular formula C8H12O3S
and a molecular weight of 188.25 g/mol. Its IUPAC name is 7-sulfanyl-1,4-dioxaspiro[4.5]decan-8-one.
Molecular Properties
| Compound Name | 7-sulfanyl-1,4-dioxaspiro[4.5]decan-8-one |
| PubChem CID | 87163817 |
| Molecular Formula | C8H12O3S |
| Molecular Weight | 188.25 g/mol |
| Exact Mass | 188.05 |
| IUPAC Name | 7-sulfanyl-1,4-dioxaspiro[4.5]decan-8-one |
| SMILES | O=C1CCC2(CC1S)OCCO2 |
| InChI | InChI=1S/C8H12O3S/c9-6-1-2-8(5-7(6)12)10-3-4-11-8/h7,12H,1-5H2 |
| InChIKey | VXTVRGLMXUQSKD-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 35.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.25 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 7-sulfanyl-1,4-dioxaspiro[4.5]decan-8-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-sulfanyl-1,4-dioxaspiro[4.5]decan-8-one?
The IUPAC name of 7-sulfanyl-1,4-dioxaspiro[4.5]decan-8-one (CID 87163817) is 7-sulfanyl-1,4-dioxaspiro[4.5]decan-8-one.
What is the SMILES notation for 7-sulfanyl-1,4-dioxaspiro[4.5]decan-8-one?
The canonical SMILES for 7-sulfanyl-1,4-dioxaspiro[4.5]decan-8-one is O=C1CCC2(CC1S)OCCO2.
What is the InChIKey of 7-sulfanyl-1,4-dioxaspiro[4.5]decan-8-one?
The InChIKey is VXTVRGLMXUQSKD-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12O3S/c9-6-1-2-8(5-7(6)12)10-3-4-11-8/h7,12H,1-5H2.
What are the key properties of 7-sulfanyl-1,4-dioxaspiro[4.5]decan-8-one?
7-sulfanyl-1,4-dioxaspiro[4.5]decan-8-one has a molecular weight of 188.25 g/mol, XLogP of 0.78, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 7-sulfanyl-1,4-dioxaspiro[4.5]decan-8-one is sourced from PubChem (CID 87163817), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).