C8H12O3S — CID 87163817
7-sulfanyl-1,4-dioxaspiro[4.5]decan-8-one (PubChem CID 87163817) has the molecular formula C8H12O3S and a molecular weight of 188.25 g/mol. Its IUPAC name is 7-sulfanyl-1,4-dioxaspiro[4.5]decan-8-one.
| Compound Name | 7-sulfanyl-1,4-dioxaspiro[4.5]decan-8-one |
|---|---|
| PubChem CID | 87163817 |
| Molecular Formula | C8H12O3S |
| Molecular Weight | 188.25 g/mol |
| Exact Mass | 188.05 |
| IUPAC Name | 7-sulfanyl-1,4-dioxaspiro[4.5]decan-8-one |
| SMILES | O=C1CCC2(CC1S)OCCO2 |
| InChI | InChI=1S/C8H12O3S/c9-6-1-2-8(5-7(6)12)10-3-4-11-8/h7,12H,1-5H2 |
| InChIKey | VXTVRGLMXUQSKD-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 35.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.25 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|