C12H17NO3 — CID 177206907
10-but-2-ynyl-1,4-dioxa-9-azaspiro[4.6]undecan-8-one (PubChem CID 177206907) has the molecular formula C12H17NO3 and a molecular weight of 223.27 g/mol. Its IUPAC name is 10-but-2-ynyl-1,4-dioxa-9-azaspiro[4.6]undecan-8-one.
| Compound Name | 10-but-2-ynyl-1,4-dioxa-9-azaspiro[4.6]undecan-8-one |
|---|---|
| PubChem CID | 177206907 |
| Molecular Formula | C12H17NO3 |
| Molecular Weight | 223.27 g/mol |
| Exact Mass | 223.12 |
| IUPAC Name | 10-but-2-ynyl-1,4-dioxa-9-azaspiro[4.6]undecan-8-one |
| SMILES | CC#CCC1CC2(CCC(=O)N1)OCCO2 |
| InChI | InChI=1S/C12H17NO3/c1-2-3-4-10-9-12(15-7-8-16-12)6-5-11(14)13-10/h10H,4-9H2,1H3,(H,13,14) |
| InChIKey | UUKABMJNJGBTMF-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.27 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|