About 7-[(E)-but-2-enyl]-1,4-dioxaspiro[4.5]decan-8-one
7-[(E)-but-2-enyl]-1,4-dioxaspiro[4.5]decan-8-one (PubChem CID 177206913) has the molecular formula C12H18O3
and a molecular weight of 210.27 g/mol. Its IUPAC name is 7-[(E)-but-2-enyl]-1,4-dioxaspiro[4.5]decan-8-one.
Molecular Properties
| Compound Name | 7-[(E)-but-2-enyl]-1,4-dioxaspiro[4.5]decan-8-one |
| PubChem CID | 177206913 |
| Molecular Formula | C12H18O3 |
| Molecular Weight | 210.27 g/mol |
| Exact Mass | 210.13 |
| IUPAC Name | 7-[(E)-but-2-enyl]-1,4-dioxaspiro[4.5]decan-8-one |
| SMILES | C/C=C/CC1CC2(CCC1=O)OCCO2 |
| InChI | InChI=1S/C12H18O3/c1-2-3-4-10-9-12(6-5-11(10)13)14-7-8-15-12/h2-3,10H,4-9H2,1H3/b3-2+ |
| InChIKey | KJSPEXIETDCNLM-NSCUHMNNSA-N |
| XLogP | 2.06 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.27 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 7-[(E)-but-2-enyl]-1,4-dioxaspiro[4.5]decan-8-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-[(E)-but-2-enyl]-1,4-dioxaspiro[4.5]decan-8-one?
The IUPAC name of 7-[(E)-but-2-enyl]-1,4-dioxaspiro[4.5]decan-8-one (CID 177206913) is 7-[(E)-but-2-enyl]-1,4-dioxaspiro[4.5]decan-8-one.
What is the SMILES notation for 7-[(E)-but-2-enyl]-1,4-dioxaspiro[4.5]decan-8-one?
The canonical SMILES for 7-[(E)-but-2-enyl]-1,4-dioxaspiro[4.5]decan-8-one is C/C=C/CC1CC2(CCC1=O)OCCO2.
What is the InChIKey of 7-[(E)-but-2-enyl]-1,4-dioxaspiro[4.5]decan-8-one?
The InChIKey is KJSPEXIETDCNLM-NSCUHMNNSA-N. The full InChI is InChI=1S/C12H18O3/c1-2-3-4-10-9-12(6-5-11(10)13)14-7-8-15-12/h2-3,10H,4-9H2,1H3/b3-2+.
What are the key properties of 7-[(E)-but-2-enyl]-1,4-dioxaspiro[4.5]decan-8-one?
7-[(E)-but-2-enyl]-1,4-dioxaspiro[4.5]decan-8-one has a molecular weight of 210.27 g/mol, XLogP of 2.06, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7-[(E)-but-2-enyl]-1,4-dioxaspiro[4.5]decan-8-one is sourced from PubChem (CID 177206913), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).