C20H38O4 — CID 135048432
(Z,2R,5S)-5-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-methyltetradec-3-ene-1,5-diol (PubChem CID 135048432) has the molecular formula C20H38O4 and a molecular weight of 342.52 g/mol. Its IUPAC name is (Z,2R,5S)-5-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-methyltetradec-3-ene-1,5-diol.
| Compound Name | (Z,2R,5S)-5-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-methyltetradec-3-ene-1,5-diol |
|---|---|
| PubChem CID | 135048432 |
| Molecular Formula | C20H38O4 |
| Molecular Weight | 342.52 g/mol |
| Exact Mass | 342.28 |
| IUPAC Name | (Z,2R,5S)-5-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-methyltetradec-3-ene-1,5-diol |
| SMILES | CCCCCCCCC[C@](O)(/C=C\[C@@H](C)CO)[C@@H]1COC(C)(C)O1 |
| InChI | InChI=1S/C20H38O4/c1-5-6-7-8-9-10-11-13-20(22,14-12-17(2)15-21)18-16-23-19(3,4)24-18/h12,14,17-18,21-22H,5-11,13,15-16H2,1-4H3/b14-12-/t17-,18+,20+/m1/s1 |
| InChIKey | LIUNERRYERRHSV-AFCDGMDYSA-N |
| XLogP | 4.19 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.52 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|