C14H26F2O2 — CID 21178127
(4R)-4-(1,1-difluorononyl)-2,2-dimethyl-1,3-dioxolane (PubChem CID 21178127) has the molecular formula C14H26F2O2 and a molecular weight of 264.36 g/mol. Its IUPAC name is (4R)-4-(1,1-difluorononyl)-2,2-dimethyl-1,3-dioxolane.
| Compound Name | (4R)-4-(1,1-difluorononyl)-2,2-dimethyl-1,3-dioxolane |
|---|---|
| PubChem CID | 21178127 |
| Molecular Formula | C14H26F2O2 |
| Molecular Weight | 264.36 g/mol |
| Exact Mass | 264.19 |
| IUPAC Name | (4R)-4-(1,1-difluorononyl)-2,2-dimethyl-1,3-dioxolane |
| SMILES | CCCCCCCCC(F)(F)[C@H]1COC(C)(C)O1 |
| InChI | InChI=1S/C14H26F2O2/c1-4-5-6-7-8-9-10-14(15,16)12-11-17-13(2,3)18-12/h12H,4-11H2,1-3H3/t12-/m1/s1 |
| InChIKey | SBLNNOHIPBMRRL-GFCCVEGCSA-N |
| XLogP | 4.52 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.36 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|