C9H14O4 — CID 11148148
(2S)-2-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl](313C)but-3-yne-1,2-diol (PubChem CID 11148148) has the molecular formula C9H14O4 and a molecular weight of 187.20 g/mol. Its IUPAC name is (2S)-2-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl](313C)but-3-yne-1,2-diol.
| Compound Name | (2S)-2-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl](313C)but-3-yne-1,2-diol |
|---|---|
| PubChem CID | 11148148 |
| Molecular Formula | C9H14O4 |
| Molecular Weight | 187.20 g/mol |
| Exact Mass | 187.09 |
| IUPAC Name | (2S)-2-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl](313C)but-3-yne-1,2-diol |
| SMILES | C#[13C][C@](O)(CO)[C@H]1COC(C)(C)O1 |
| InChI | InChI=1S/C9H14O4/c1-4-9(11,6-10)7-5-12-8(2,3)13-7/h1,7,10-11H,5-6H2,2-3H3/t7-,9+/m1/s1/i4+1 |
| InChIKey | UDSGHEJAGZLAMO-DAFGXJKDSA-N |
| XLogP | -0.51 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.20 |
| LogP ≤ 5 | -0.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|