C26H12BF10- — CID 135048705
bis(2,3,4,5,6-pentafluorophenyl)-phenyl-[(E)-2-phenylethenyl]boranuide (PubChem CID 135048705) has the molecular formula C26H12BF10- and a molecular weight of 525.17 g/mol. Its IUPAC name is bis(2,3,4,5,6-pentafluorophenyl)-phenyl-[(E)-2-phenylethenyl]boranuide.
| Compound Name | bis(2,3,4,5,6-pentafluorophenyl)-phenyl-[(E)-2-phenylethenyl]boranuide |
|---|---|
| PubChem CID | 135048705 |
| Molecular Formula | C26H12BF10- |
| Molecular Weight | 525.17 g/mol |
| Exact Mass | 525.09 |
| IUPAC Name | bis(2,3,4,5,6-pentafluorophenyl)-phenyl-[(E)-2-phenylethenyl]boranuide |
| SMILES | Fc1c(F)c(F)c([B-](/C=C/c2ccccc2)(c2ccccc2)c2c(F)c(F)c(F)c(F)c2F)c(F)c1F |
| InChI | InChI=1S/C26H12BF10/c28-17-15(18(29)22(33)25(36)21(17)32)27(14-9-5-2-6-10-14,12-11-13-7-3-1-4-8-13)16-19(30)23(34)26(37)24(35)20(16)31/h1-12H/q-1/b12-11+ |
| InChIKey | WVHDREUXCSMGCB-VAWYXSNFSA-N |
| XLogP | 5.80 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.17 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|