About lithium 1-bromo-3,3-diethoxyprop-1-ene
lithium 1-bromo-3,3-diethoxyprop-1-ene (PubChem CID 135049840) has the molecular formula C7H12BrLiO2
and a molecular weight of 215.02 g/mol. Its IUPAC name is lithium 1-bromo-3,3-diethoxyprop-1-ene.
Molecular Properties
| Compound Name | lithium 1-bromo-3,3-diethoxyprop-1-ene |
| PubChem CID | 135049840 |
| Molecular Formula | C7H12BrLiO2 |
| Molecular Weight | 215.02 g/mol |
| Exact Mass | 214.02 |
| IUPAC Name | lithium 1-bromo-3,3-diethoxyprop-1-ene |
| SMILES | CCOC(/C=[C-]\Br)OCC.[Li+] |
| InChI | InChI=1S/C7H12BrO2.Li/c1-3-9-7(5-6-8)10-4-2;/h5,7H,3-4H2,1-2H3;/q-1;+1 |
| InChIKey | WAAUFOJZCANROJ-UHFFFAOYSA-N |
| XLogP | -0.90 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.02 |
| LogP ≤ 5 | -0.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze lithium 1-bromo-3,3-diethoxyprop-1-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of lithium 1-bromo-3,3-diethoxyprop-1-ene?
The IUPAC name of lithium 1-bromo-3,3-diethoxyprop-1-ene (CID 135049840) is lithium 1-bromo-3,3-diethoxyprop-1-ene.
What is the SMILES notation for lithium 1-bromo-3,3-diethoxyprop-1-ene?
The canonical SMILES for lithium 1-bromo-3,3-diethoxyprop-1-ene is CCOC(/C=[C-]\Br)OCC.[Li+].
What is the InChIKey of lithium 1-bromo-3,3-diethoxyprop-1-ene?
The InChIKey is WAAUFOJZCANROJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12BrO2.Li/c1-3-9-7(5-6-8)10-4-2;/h5,7H,3-4H2,1-2H3;/q-1;+1.
What are the key properties of lithium 1-bromo-3,3-diethoxyprop-1-ene?
lithium 1-bromo-3,3-diethoxyprop-1-ene has a molecular weight of 215.02 g/mol, XLogP of -0.90, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for lithium 1-bromo-3,3-diethoxyprop-1-ene is sourced from PubChem (CID 135049840), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).