About 1-bromo-3,3-diethoxyprop-1-ene
1-bromo-3,3-diethoxyprop-1-ene (PubChem CID 73183692) has the molecular formula C7H13BrO2
and a molecular weight of 209.08 g/mol. Its IUPAC name is 1-bromo-3,3-diethoxyprop-1-ene.
Molecular Properties
| Compound Name | 1-bromo-3,3-diethoxyprop-1-ene |
| PubChem CID | 73183692 |
| Molecular Formula | C7H13BrO2 |
| Molecular Weight | 209.08 g/mol |
| Exact Mass | 208.01 |
| IUPAC Name | 1-bromo-3,3-diethoxyprop-1-ene |
| SMILES | CCOC(C=CBr)OCC |
| InChI | InChI=1S/C7H13BrO2/c1-3-9-7(5-6-8)10-4-2/h5-7H,3-4H2,1-2H3 |
| InChIKey | LIYQUVXOICRLQR-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.08 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 1-bromo-3,3-diethoxyprop-1-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-bromo-3,3-diethoxyprop-1-ene?
The IUPAC name of 1-bromo-3,3-diethoxyprop-1-ene (CID 73183692) is 1-bromo-3,3-diethoxyprop-1-ene.
What is the SMILES notation for 1-bromo-3,3-diethoxyprop-1-ene?
The canonical SMILES for 1-bromo-3,3-diethoxyprop-1-ene is CCOC(C=CBr)OCC.
What is the InChIKey of 1-bromo-3,3-diethoxyprop-1-ene?
The InChIKey is LIYQUVXOICRLQR-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H13BrO2/c1-3-9-7(5-6-8)10-4-2/h5-7H,3-4H2,1-2H3.
What are the key properties of 1-bromo-3,3-diethoxyprop-1-ene?
1-bromo-3,3-diethoxyprop-1-ene has a molecular weight of 209.08 g/mol, XLogP of 2.29, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-bromo-3,3-diethoxyprop-1-ene is sourced from PubChem (CID 73183692), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).