C7H12Br2O2 — CID 101491863
1,1-dibromo-3,3-diethoxy(113C)prop-1-ene (PubChem CID 101491863) has the molecular formula C7H12Br2O2 and a molecular weight of 288.97 g/mol. Its IUPAC name is 1,1-dibromo-3,3-diethoxy(113C)prop-1-ene.
| Compound Name | 1,1-dibromo-3,3-diethoxy(113C)prop-1-ene |
|---|---|
| PubChem CID | 101491863 |
| Molecular Formula | C7H12Br2O2 |
| Molecular Weight | 288.97 g/mol |
| Exact Mass | 286.92 |
| IUPAC Name | 1,1-dibromo-3,3-diethoxy(113C)prop-1-ene |
| SMILES | CCOC(C=[13C](Br)Br)OCC |
| InChI | InChI=1S/C7H12Br2O2/c1-3-10-7(11-4-2)5-6(8)9/h5,7H,3-4H2,1-2H3/i6+1 |
| InChIKey | YLRINNVJAZFGBW-PTQBSOBMSA-N |
| XLogP | 3.02 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.97 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|