C18H22O4S — CID 135050508
[(4aR)-7-oxo-1,2,3,4,5,6-hexahydronaphthalen-4a-yl]methyl 4-methylbenzenesulfonate (PubChem CID 135050508) has the molecular formula C18H22O4S and a molecular weight of 334.44 g/mol. Its IUPAC name is [(4aR)-7-oxo-1,2,3,4,5,6-hexahydronaphthalen-4a-yl]methyl 4-methylbenzenesulfonate.
| Compound Name | [(4aR)-7-oxo-1,2,3,4,5,6-hexahydronaphthalen-4a-yl]methyl 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 135050508 |
| Molecular Formula | C18H22O4S |
| Molecular Weight | 334.44 g/mol |
| Exact Mass | 334.12 |
| IUPAC Name | [(4aR)-7-oxo-1,2,3,4,5,6-hexahydronaphthalen-4a-yl]methyl 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OC[C@@]23CCCCC2=CC(=O)CC3)cc1 |
| InChI | InChI=1S/C18H22O4S/c1-14-5-7-17(8-6-14)23(20,21)22-13-18-10-3-2-4-15(18)12-16(19)9-11-18/h5-8,12H,2-4,9-11,13H2,1H3/t18-/m0/s1 |
| InChIKey | QANRUKPFWFLANX-SFHVURJKSA-N |
| XLogP | 3.55 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.44 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|