About (1-chloro-2-hydroxy-1-phenyloctan-2-yl) methanimidate
(1-chloro-2-hydroxy-1-phenyloctan-2-yl) methanimidate (PubChem CID 135050769) has the molecular formula C15H22ClNO2
and a molecular weight of 283.80 g/mol. Its IUPAC name is (1-chloro-2-hydroxy-1-phenyloctan-2-yl) methanimidate.
Molecular Properties
| Compound Name | (1-chloro-2-hydroxy-1-phenyloctan-2-yl) methanimidate |
| PubChem CID | 135050769 |
| Molecular Formula | C15H22ClNO2 |
| Molecular Weight | 283.80 g/mol |
| Exact Mass | 283.13 |
| IUPAC Name | (1-chloro-2-hydroxy-1-phenyloctan-2-yl) methanimidate |
| SMILES | [H]/N=C/OC(O)(CCCCCC)C(Cl)c1ccccc1 |
| InChI | InChI=1S/C15H22ClNO2/c1-2-3-4-8-11-15(18,19-12-17)14(16)13-9-6-5-7-10-13/h5-7,9-10,12,14,17-18H,2-4,8,11H2,1H3/b17-12+ |
| InChIKey | ZJGLJPXBKAPLFK-SFQUDFHCSA-N |
| XLogP | 4.25 |
| TPSA | 53.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 283.80 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze (1-chloro-2-hydroxy-1-phenyloctan-2-yl) methanimidate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1-chloro-2-hydroxy-1-phenyloctan-2-yl) methanimidate?
The IUPAC name of (1-chloro-2-hydroxy-1-phenyloctan-2-yl) methanimidate (CID 135050769) is (1-chloro-2-hydroxy-1-phenyloctan-2-yl) methanimidate.
What is the SMILES notation for (1-chloro-2-hydroxy-1-phenyloctan-2-yl) methanimidate?
The canonical SMILES for (1-chloro-2-hydroxy-1-phenyloctan-2-yl) methanimidate is [H]/N=C/OC(O)(CCCCCC)C(Cl)c1ccccc1.
What is the InChIKey of (1-chloro-2-hydroxy-1-phenyloctan-2-yl) methanimidate?
The InChIKey is ZJGLJPXBKAPLFK-SFQUDFHCSA-N. The full InChI is InChI=1S/C15H22ClNO2/c1-2-3-4-8-11-15(18,19-12-17)14(16)13-9-6-5-7-10-13/h5-7,9-10,12,14,17-18H,2-4,8,11H2,1H3/b17-12+.
What are the key properties of (1-chloro-2-hydroxy-1-phenyloctan-2-yl) methanimidate?
(1-chloro-2-hydroxy-1-phenyloctan-2-yl) methanimidate has a molecular weight of 283.80 g/mol, XLogP of 4.25, 9 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (1-chloro-2-hydroxy-1-phenyloctan-2-yl) methanimidate is sourced from PubChem (CID 135050769), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).