C17H13N3OS — CID 135050778
[(Z,3E)-3-(benzoylhydrazinylidene)-1-phenylprop-1-enyl] thiocyanate (PubChem CID 135050778) has the molecular formula C17H13N3OS and a molecular weight of 307.38 g/mol. Its IUPAC name is [(Z,3E)-3-(benzoylhydrazinylidene)-1-phenylprop-1-enyl] thiocyanate.
| Compound Name | [(Z,3E)-3-(benzoylhydrazinylidene)-1-phenylprop-1-enyl] thiocyanate |
|---|---|
| PubChem CID | 135050778 |
| Molecular Formula | C17H13N3OS |
| Molecular Weight | 307.38 g/mol |
| Exact Mass | 307.08 |
| IUPAC Name | [(Z,3E)-3-(benzoylhydrazinylidene)-1-phenylprop-1-enyl] thiocyanate |
| SMILES | N#CS/C(=C\C=N\NC(=O)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C17H13N3OS/c18-13-22-16(14-7-3-1-4-8-14)11-12-19-20-17(21)15-9-5-2-6-10-15/h1-12H,(H,20,21)/b16-11-,19-12+ |
| InChIKey | BSXTYTADSSMXJA-XRWSEXJESA-N |
| XLogP | 3.66 |
| TPSA | 65.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.38 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|